Wikidata entity: Q82299560
C₁₇H₁₉FN₂O₂ (P274)
Quantities
| P2067 | mass | 302.143056068 |
| P233 | canonical SMILES | String | CC(NCc1ccc(OCc2cccc(F)c2)cc1)C(N)=O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 133866-14-5 |
| P8494 | DSSTOX compound identifier | DTXCID10421949 |
| P3117 | DSSTox substance ID | DTXSID80471133 |
| P2057 | Human Metabolome Database ID | HMDB0257441 |
| P234 | InChI | InChI=1S/C17H19FN2O2/c1-12(17(19)21)20-10-13-5-7-16(8-6-13)22-11-14-3-2-4-15(18)9-14/h2-9,12,20H,10-11H2,1H3,(H2,19,21) |
| P235 | InChIKey | NEMGRZFTLSKBAP-UHFFFAOYSA-N |
| P662 | PubChem CID | 11722448 |
| P2877 | SureChEMBL ID | 69351 |
| P2877 | SureChEMBL ID | 31174565 |
| P11089 | UniChem compound ID | 358488 |
Why not click here or view trends?
log id: 10369063