Wikidata entity: Q82568188
C₂₆H₂₄N₂O₃ (P274)
Quantities
| P2067 | mass | 412.178692628 |
| P233 | canonical SMILES | String | O=C(NC(CO)Cc1c[nH]c2ccccc12)OCC1c2ccccc2-c2ccccc21 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=CC=CC=C54)CO | ??? |
| P279 | subclass of | ... | Q66589878 (tryptamine alkaloid) | tryptamine alkaloid |
| P231 | CAS Registry Number | 153815-60-2 |
| P8494 | DSSTOX compound identifier | DTXCID60605050 |
| P3117 | DSSTox substance ID | DTXSID00654300 |
| P234 | InChI | InChI=1S/C26H24N2O3/c29-15-18(13-17-14-27-25-12-6-5-7-19(17)25)28-26(30)31-16-24-22-10-3-1-8-20(22)21-9-2-4-11-23(21)24/h1-12,14,18,24,27,29H,13,15-16H2,(H,28,30)/t18-/m0/s1 |
| P235 | InChIKey | TYDUDYNHTCJBHI-SFHVURJKSA-N |
| P662 | PubChem CID | 40428325 |
| P2877 | SureChEMBL ID | 29400665 |
| P11089 | UniChem compound ID | 2920435 |
Why not click here or view trends?
log id: 5799281