| type of chemical entity | Q113145171 |
| isoflavonoid | Q3234924 |
| 3',6C-diprenylisoflavone | Q108800372 |
| 3-chromene | Q109583425 |
| P233 | canonical SMILES | O=C1C(=COC2=CC(O)=C(C(O)=C12)CC=C(C)C)C=3C=CC=4OC(C=CC4C3O)(C)C |
| P231 | CAS Registry Number | 100462-54-2 |
| P683 | ChEBI ID | 178569 |
| P8494 | DSSTOX compound identifier | DTXCID3065794 |
| P3117 | DSSTox substance ID | DTXSID80143303 |
| P234 | InChI | InChI=1S/C25H24O6/c1-13(2)5-6-15-18(26)11-20-21(23(15)28)24(29)17(12-30-20)14-7-8-19-16(22(14)27)9-10-25(3,4)31-19/h5,7-12,26-28H,6H2,1-4H3 |
| P235 | InChIKey | QQUXNFZAFOMGTQ-UHFFFAOYSA-N |
| P2064 | KNApSAcK ID | C00009919 |
| P2063 | LIPID MAPS ID | LMPK12050322 |
| P662 | PubChem CID | 5481235 |
| P11089 | UniChem compound ID | 68529411 |
| P703 | found in taxon | Lupinus albus | Q161372 |
| Lupinus angustifolius | Q164148 | ||
| Glycyrrhiza inflata | Q5572787 | ||
| P2067 | mass | 420.157288488 |
| Q104946394 | Isoflavones from Lupinus angustifolius root |
| Q52763740 | Isoflavonoids as insect feeding deterrents and antifungal components from root ofLupinus angustifolius. |
| Q104384985 | Naturally Occurring Coumaranochroman-4-Ones: A New Class Of Isoflavonoids From Lupins And Jamaican Dogwood |
| Q85035741 | Screening and characterization of natural antioxidants in four Glycyrrhiza species by liquid chromatography coupled with electrospray ionization quadrupole time-of-flight tandem mass spectrometry |
| Q36376001 | Screening for bioactive natural products from a 67-compound library of Glycyrrhiza inflata |
| Q104914071 | Seventeen isoflavonoids from Lupinus albus roots |