Wikidata entity: Q855468
C₂₇H₃₇N₃OS (P274)

Quantities
| P2067 | mass | 451.265734 |
| P233 | canonical SMILES | String | CSC1=CC=CC=C1N2CCN(CC2)CCCCCC(=O)NC3CCCC4=CC=CC=C34 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21115043 (5-hydroxytryptamine receptor 1A) | 5-hydroxytryptamine receptor 1A |
| P129 | physically interacts with | ... | Q1949517 (5-hydroxytryptamine receptor 2A) | 5-hydroxytryptamine receptor 2A |
| P129 | physically interacts with | ... | Q2034004 (Dopamine receptor D2) | Dopamine receptor D2 |
| P129 | physically interacts with | ... | Q21109355 (5-hydroxytryptamine receptor 7) | 5-hydroxytryptamine receptor 7 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 824958-12-5 |
| P592 | ChEMBL ID | CHEMBL225284 |
| P661 | ChemSpider ID | 9399811 |
| P8494 | DSSTOX compound identifier | DTXCID60410126 |
| P3117 | DSSTox substance ID | DTXSID50459307 |
| P646 | Freebase ID | /m/0h52rdv |
| P595 | Guide to Pharmacology Ligand ID | 8435 |
| P234 | InChI | InChI=1S/C27H37N3OS/c1-32-26-15-7-6-14-25(26)30-20-18-29(19-21-30)17-8-2-3-16-27(31)28-24-13-9-11-22-10-4-5-12-23(22)24/h4-7,10,12,14-15,24H,2-3,8-9,11,13,16-21H2,1H3,(H,28,31) |
| P235 | InChIKey | JNBBJUHCODFLEG-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2779705220 |
| P11199 | Probes And Drugs ID | PD046691 |
| P662 | PubChem CID | 11224758 |
| P2877 | SureChEMBL ID | 4463237 |
| P2877 | SureChEMBL ID | 29383152 |
| P2877 | SureChEMBL ID | 29772995 |
| P11089 | UniChem compound ID | 527627 |
Why not click here or view trends?
log id: 974496