Wikidata entity: Q905058
C₁₈H₁₈N₄O₂ (P274)
Quantities
| P2067 | mass | 322.142975816 |
| P233 | canonical SMILES | String | CC(CC1=CC=CC=C1)[N+]2=NOC(=C2)N=C(NC3=CC=CC=C3)[O-] | ??? |
| P1343 | described by source | ... | Q316572 (Opium Law) | Opium Law |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q76560 (antidepressant) | antidepressant |
| P2868 | subject has role | ... | Q211036 (stimulant) | stimulant |
| P2868 | subject has role | ... | Q576618 (anticonvulsant agent) | anticonvulsant agent |
| P2868 | subject has role | ... | Q598405 (sympathomimetic drug) | sympathomimetic drug |
| P231 | CAS Registry Number | 34262-84-5 |
| P661 | ChemSpider ID | 16736988 |
| P8494 | DSSTOX compound identifier | DTXCID601329394 |
| P3117 | DSSTox substance ID | DTXSID10900961 |
| P646 | Freebase ID | /m/02qtpt1 |
| P2057 | Human Metabolome Database ID | HMDB0254478 |
| P234 | InChI | InChI=1S/C18H18N4O2/c1-14(12-15-8-4-2-5-9-15)22-13-17(24-21-22)20-18(23)19-16-10-6-3-7-11-16/h2-11,13-14H,12H2,1H3,(H-,19,20,21,23) |
| P235 | InChIKey | OWFUPROYPKGHMH-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | C009257 |
| P6366 | Microsoft Academic ID (discontinued) | 2776934491 |
| P11199 | Probes And Drugs ID | PD159896 |
| P662 | PubChem CID | 71932 |
| P662 | PubChem CID | 5931174 |
| P662 | PubChem CID | 9551611 |
| P2877 | SureChEMBL ID | 29465234 |
| P2892 | UMLS CUI | C0074500 |
| P652 | UNII | UMT8MP2NDU |
Why not click here or view trends?
log id: 5072955