Wikidata entity: Q9357475
C₅H₁₀O₂ (P274)
Quantities
| P2067 | mass | 102.06808 |
| P1109 | refractive index | 1.439 |
| P233 | canonical SMILES | String | CC(=O)CCCO | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 1071-73-4 |
| P2072 | CDB Chemical ID | 6692143 |
| P683 | ChEBI ID | 195472 |
| P661 | ChemSpider ID | 13447 |
| P8494 | DSSTOX compound identifier | DTXCID9070408 |
| P3117 | DSSTox substance ID | DTXSID30147917 |
| P232 | EC number | 213-994-8 |
| P2566 | ECHA Substance Infocard ID | 100.012.723 |
| P2671 | Google Knowledge Graph ID | /g/155sbfjd |
| P2057 | Human Metabolome Database ID | HMDB0245797 |
| P234 | InChI | InChI=1S/C5H10O2/c1-5(7)3-2-4-6/h6H,2-4H2,1H3 |
| P235 | InChIKey | JSHPTIGHEWEXRW-UHFFFAOYSA-N |
| P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP008874 |
| P2840 | NSC number | 33940 |
| P2840 | NSC number | 19158 |
| P662 | PubChem CID | 14066 |
| P4964 | SPLASH | splash10-0006-9000000000-4bde53f9dab9fdcbca77 |
| P2877 | SureChEMBL ID | 53922 |
| P11089 | UniChem compound ID | 5261415 |
| P2084 | ZINC ID | 1562396 |
Why not click here or view trends?
log id: 3571502