Wikidata entity: Q106039178
C₂₄H₂₆FNO₄ (P274)
Quantities
| P2067 | mass | 411.18458653199997 |
| P233 | canonical SMILES | String | CC(C)n1c(C=CC(O)CC(O)CC(=O)O)c(-c2ccc(F)cc2)c2ccccc21 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC(C)n1c(/C=C/[C@H](O)C[C@H](O)CC(=O)O)c(-c2ccc(F)cc2)c2ccccc21 | ??? |
| P3364 | stereoisomer of | ... | Q417942 (fluvastatin) | fluvastatin |
| P3364 | stereoisomer of | ... | Q27117903 (fluvastatin sodium anti-isomer free acid) | fluvastatin sodium anti-isomer free acid |
| P3364 | stereoisomer of | ... | Q27117904 ((3S,5S,6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid) | (3S,5S,6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid |
| P3364 | stereoisomer of | ... | Q27164881 ((3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-yl-2-indolyl]-3,5-dihydroxy-6-heptenoic acid) | (3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-yl-2-indolyl]-3,5-dihydroxy-6-heptenoic acid |
| P3364 | stereoisomer of | ... | Q27166430 ((3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-yl-2-indolyl]-3,5-dihydroxy-6-heptenoic acid) | (3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-yl-2-indolyl]-3,5-dihydroxy-6-heptenoic acid |
| P279 | subclass of | ... | Q106039176 (rac-(±)-fluvastatin) | rac-(±)-fluvastatin |
| P231 | CAS Registry Number | 93957-54-1 |
| P683 | ChEBI ID | 38561 |
| P683 | ChEBI ID | 5136 |
| P11198 | DrugCentral ID | 1229 |
| P2057 | Human Metabolome Database ID | HMDB0015227 |
| P234 | InChI | InChI=1S/C24H26FNO4/c1-15(2)26-21-6-4-3-5-20(21)24(16-7-9-17(25)10-8-16)22(26)12-11-18(27)13-19(28)14-23(29)30/h3-12,15,18-19,27-28H,13-14H2,1-2H3,(H,29,30)/b12-11+/t18-,19-/m0/s1 |
| P235 | InChIKey | FJLGEFLZQAZZCD-JUFISIKESA-N |
| P11199 | Probes And Drugs ID | PD018885 |
| P662 | PubChem CID | 1548972 |
| P2877 | SureChEMBL ID | 2847 |
| P11089 | UniChem compound ID | 1004545 |
| P652 | UNII | 4L066368AS |
Why not click here or view trends?
log id: 4694271