Wikidata entity: Q27164881
C₂₄H₂₆FNO₄ (P274)
Quantities
| P2067 | mass | 411.184587 |
| P233 | canonical SMILES | String | CC(C)N1C2=CC=CC=C2C(=C1C=CC(CC(CC(=O)O)O)O)C3=CC=C(C=C3)F | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC(C)N1C2=CC=CC=C2C(=C1C=C[C@H](C[C@H](CC(=O)O)O)O)C3=CC=C(C=C3)F | ??? |
| P3364 | stereoisomer of | ... | Q417942 (fluvastatin) | fluvastatin |
| P3364 | stereoisomer of | ... | Q27117903 (fluvastatin sodium anti-isomer free acid) | fluvastatin sodium anti-isomer free acid |
| P3364 | stereoisomer of | ... | Q27117904 ((3S,5S,6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid) | (3S,5S,6E)-7-[3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indol-2-yl]-3,5-dihydroxyhept-6-enoic acid |
| P3364 | stereoisomer of | ... | Q27166430 ((3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-yl-2-indolyl]-3,5-dihydroxy-6-heptenoic acid) | (3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-yl-2-indolyl]-3,5-dihydroxy-6-heptenoic acid |
| P3364 | stereoisomer of | ... | Q106039178 ((3S,5R)-fluvastatin) | (3S,5R)-fluvastatin |
| P279 | subclass of | ... | Q27166956 (7-[3-(4-fluorophenyl)-1-propan-2-yl-2-indolyl]-3,5-dihydroxy-6-heptenoic acid) | 7-[3-(4-fluorophenyl)-1-propan-2-yl-2-indolyl]-3,5-dihydroxy-6-heptenoic acid |
| P683 | ChEBI ID | 93160 |
| P661 | ChemSpider ID | 129478 |
| P234 | InChI | InChI=1S/C24H26FNO4/c1-15(2)26-21-6-4-3-5-20(21)24(16-7-9-17(25)10-8-16)22(26)12-11-18(27)13-19(28)14-23(29)30/h3-12,15,18-19,27-28H,13-14H2,1-2H3,(H,29,30)/t18-,19-/m1/s1 |
| P235 | InChIKey | FJLGEFLZQAZZCD-RTBURBONSA-N |
| P662 | PubChem CID | 146801 |
| P2877 | SureChEMBL ID | 556754 |
| P11089 | UniChem compound ID | 26894905 |
Why not click here or view trends?
log id: 4721536