Wikidata entity: Q106345558
C₉H₁₆N₄O₄ (P274)
Quantities
| P2067 | mass | 244.117154992 |
| P233 | canonical SMILES | String | N=C(N)NCCC(O)C(C(=O)O)N1CCC1=O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | N=C(N)NCC[C@@H](O)[C@@H](C(=O)O)N1CCC1=O | ??? |
| P361 | part of | ... | Q22316488 (clavaminate synthase activity) | clavaminate synthase activity |
| P361 | part of | ... | Q22320974 (proclavaminate amidinohydrolase activity) | proclavaminate amidinohydrolase activity |
| P3364 | stereoisomer of | ... | Q27104247 (amidinoproclavaminic acid) | amidinoproclavaminic acid |
| P279 | subclass of | ... | Q105169638 (3-Hydroxy-5-guanidino-2-(2-oxoazetidin-1-yl)pentanoic acid) | 3-Hydroxy-5-guanidino-2-(2-oxoazetidin-1-yl)pentanoic acid |
| P6185 | tautomer of | ... | Q27104247 (amidinoproclavaminic acid) | amidinoproclavaminic acid |
| P683 | ChEBI ID | 58647 |
| P683 | ChEBI ID | 32963 |
| P234 | InChI | InChI=1S/C9H16N4O4/c10-9(11)12-3-1-5(14)7(8(16)17)13-4-2-6(13)15/h5,7,14H,1-4H2,(H,16,17)(H4,10,11,12)/t5-,7+/m1/s1 |
| P235 | InChIKey | MPNWPLYZGCKKFY-VDTYLAMSSA-N |
| P662 | PubChem CID | 441124 |
| P662 | PubChem CID | 25200876 |
Why not click here or view trends?
log id: 5435853