| P3780 |
active ingredient in |
... |
Q29005907 (Glivec) |
Glivec |
| P3780 |
active ingredient in |
... |
Q29005961 (Imatinib Accord) |
Imatinib Accord |
| P3780 |
active ingredient in |
... |
Q29005963 (Imatinib Actavis) |
Imatinib Actavis |
| P3780 |
active ingredient in |
... |
Q29005965 (Imatinib Medac) |
Imatinib Medac |
| P3780 |
active ingredient in |
... |
Q29005966 (Imatinib Teva) |
Imatinib Teva |
| P233 |
canonical SMILES |
String |
CC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)CN3CCN(CC3)C)NC4=NC=CC(=N4)C5=CN=CC=C5 |
??? |
| P373 |
Commons category |
String |
Imatinib |
??? |
| P527 |
has part(s) |
... |
Q623 (carbon) |
carbon |
| P527 |
has part(s) |
... |
Q627 (nitrogen) |
nitrogen |
| P366 |
has use |
... |
Q12140 (medication) |
medication |
| P8224 |
image of molecular model or crystal lattice model |
CommonsMedia |
http://commons.wikimedia.org/wiki/Special:FilePath/Imatinib%20molecule%20ball.png |
??? |
| P8224 |
image of molecular model or crystal lattice model |
CommonsMedia |
http://commons.wikimedia.org/wiki/Special:FilePath/Imatinib%20molecule%20spacefill.png |
??? |
| P31 |
instance of |
... |
Q113145171 (type of chemical entity) |
type of chemical entity |
| P8026 |
LiverTox likelihood score |
... |
Q83284157 (LiverTox toxicity likelihood category B) |
LiverTox toxicity likelihood category B |
| P2175 |
medical condition treated |
... |
Q29496 (leukemia) |
leukemia |
| P2175 |
medical condition treated |
... |
Q264118 (acute myeloid leukemia) |
acute myeloid leukemia |
| P2175 |
medical condition treated |
... |
Q1495661 (gastrointestinal stromal tumor) |
gastrointestinal stromal tumor |
| P2175 |
medical condition treated |
... |
Q1194520 (graft-versus-host disease) |
graft-versus-host disease |
| P2175 |
medical condition treated |
... |
Q1200239 (dermatofibrosarcoma protuberans) |
dermatofibrosarcoma protuberans |
| P2175 |
medical condition treated |
... |
Q18553565 (gastrointestinal carcinoma) |
gastrointestinal carcinoma |
| P2175 |
medical condition treated |
... |
Q18553680 (connective tissue benign neoplasm) |
connective tissue benign neoplasm |
| P2175 |
medical condition treated |
... |
Q18556538 (small intestine carcinoma) |
small intestine carcinoma |
| P129 |
physically interacts with |
... |
Q587961 (ABL proto-oncogene 1, non-receptor tyrosine kinase) |
ABL proto-oncogene 1, non-receptor tyrosine kinase |
| P129 |
physically interacts with |
... |
Q909409 (KIT proto-oncogene, receptor tyrosine kinase) |
KIT proto-oncogene, receptor tyrosine kinase |
| P129 |
physically interacts with |
... |
Q21108624 (Platelet derived growth factor receptor beta) |
Platelet derived growth factor receptor beta |
| P3489 |
pregnancy category |
... |
Q3679274 (Australian pregnancy category D) |
Australian pregnancy category D |
| P3489 |
pregnancy category |
... |
Q28123618 (US pregnancy category D) |
US pregnancy category D |
| P769 |
significant drug interaction |
... |
Q113368879 (rac-warfarin) |
rac-warfarin |
| P769 |
significant drug interaction |
... |
Q5908266 (idelalisib) |
idelalisib |
| P769 |
significant drug interaction |
... |
Q5984881 (ibrutinib) |
ibrutinib |
| P279 |
subclass of |
... |
Q11173 (chemical compound) |
chemical compound |
| P2868 |
subject has role |
... |
Q35456 (essential medicine) |
essential medicine |
| P2868 |
subject has role |
... |
Q7251487 (protein kinase inhibitors) |
protein kinase inhibitors |
| P2868 |
subject has role |
... |
Q906415 (tyrosine-kinase inhibitor) |
tyrosine-kinase inhibitor |
| P2275 |
World Health Organisation international non-proprietary name |
Monolingualtext |
imatinib |
??? |
| P267 | ATC code | L01XE01 |
| P231 | CAS Registry Number | 152459-95-5 |
| P683 | ChEBI ID | 45783 |
| P592 | ChEMBL ID | CHEMBL941 |
| P661 | ChemSpider ID | 5101 |
| P715 | DrugBank ID | DB00619 |
| P11198 | DrugCentral ID | 1423 |
| P8494 | DSSTOX compound identifier | DTXCID1017125 |
| P3117 | DSSTox substance ID | DTXSID3037125 |
| P232 | EC number | 604-855-6 |
| P2566 | ECHA Substance Infocard ID | 100.122.739 |
| P9635 | electronic Essential Medicines List medicine ID | 95 |
| P1417 | Encyclopædia Britannica Online ID | science/imatinib |
| P646 | Freebase ID | /m/02q6kr |
| P595 | Guide to Pharmacology Ligand ID | 5687 |
| P2057 | Human Metabolome Database ID | HMDB0014757 |
| P234 | InChI | InChI=1S/C29H31N7O/c1-21-5-10-25(18-27(21)34-29-31-13-11-26(33-29)24-4-3-12-30-19-24)32-28(37)23-8-6-22(7-9-23)20-36-16-14-35(2)15-17-36/h3-13,18-19H,14-17,20H2,1-2H3,(H,32,37)(H,31,33,34) |
| P235 | InChIKey | KTUFNOKKBVMGRW-UHFFFAOYSA-N |
| P665 | KEGG ID | D08066 |
| P7830 | LiverTox ID | Imatinib |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363301 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363302 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363303 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363304 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363305 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363306 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363307 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363308 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363309 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363351 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363352 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363353 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363354 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363355 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363356 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363357 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363358 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ363359 |
| P6689 | MassBank accession ID | SM852103 |
| P10245 | MedlinePlus drug identifier | a606018 |
| P6694 | MeSH concept ID | M0424454 |
| P6366 | Microsoft Academic ID (discontinued) | 2777583451 |
| P2115 | NDF-RT ID | N0000148698 |
| P2840 | NSC number | 743414 |
| P2840 | NSC number | 759854 |
| P10283 | OpenAlex ID | C2777583451 |
| P3636 | PDB ligand ID | STI |
| P638 | PDB structure ID | 4BKJ |
| P638 | PDB structure ID | 3MS9 |
| P638 | PDB structure ID | 3OEZ |
| P638 | PDB structure ID | 3FW1 |
| P638 | PDB structure ID | 1OPJ |
| P638 | PDB structure ID | 2PL0 |
| P638 | PDB structure ID | 3PYY |
| P638 | PDB structure ID | 4CSV |
| P638 | PDB structure ID | 3K5V |
| P638 | PDB structure ID | 2HYY |
| P638 | PDB structure ID | 3GVU |
| P638 | PDB structure ID | 2OIQ |
| P638 | PDB structure ID | 1XBB |
| P638 | PDB structure ID | 4R7I |
| P638 | PDB structure ID | 1IEP |
| P638 | PDB structure ID | 3HEC |
| P638 | PDB structure ID | 1T46 |
| P638 | PDB structure ID | 3MSS |
| P11199 | Probes And Drugs ID | PD001319 |
| P662 | PubChem CID | 5291 |
| P1579 | Reaxys registry number | 7671333 |
| P3345 | RxNorm CUI | 282388 |
| P4964 | SPLASH | splash10-0f6x-0159500000-576f293e026deaa1ec7f |
| P4964 | SPLASH | splash10-0f9f-5930000000-71f05e812cf29e11cc69 |
| P4964 | SPLASH | splash10-0ik9-0495000000-06102c4afd3c2e88cf87 |
| P4964 | SPLASH | splash10-0006-0000900000-3974d719909aa7a75039 |
| P4964 | SPLASH | splash10-0006-0000900000-dd386ae17930da36c11f |
| P4964 | SPLASH | splash10-0006-1029200000-acd76280414e767f0280 |
| P4964 | SPLASH | splash10-0006-2269000000-f55e5c707c9de5ba2d0f |
| P4964 | SPLASH | splash10-0006-3379600000-f122458b106bcf2c8b8e |
| P4964 | SPLASH | splash10-00ba-3494000000-19e7d8361f050ec8b637 |
| P4964 | SPLASH | splash10-00ba-3693000000-c1e011113081e3341bba |
| P4964 | SPLASH | splash10-00ku-5910000000-3f91ea6a6f7402767a78 |
| P4964 | SPLASH | splash10-014i-9000000000-0638bee21655c0e0ca00 |
| P4964 | SPLASH | splash10-014i-9000000000-76f9b62b017fe8241e67 |
| P4964 | SPLASH | splash10-0159-4910000000-25480eb9451aee843c26 |
| P4964 | SPLASH | splash10-029i-7900000000-507c771376ea4b799b6d |
| P4964 | SPLASH | splash10-03ka-0971000000-b487f693e17cba198e37 |
| P4964 | SPLASH | splash10-0596-5981000000-a0f689cd067d45644bcd |
| P4964 | SPLASH | splash10-05fs-0930000000-9319811c561fd5cc8f2f |
| P2877 | SureChEMBL ID | 3827 |
| P2892 | UMLS CUI | C0935989 |
| P11089 | UniChem compound ID | 411915 |
| P652 | UNII | BKJ8M8G5HI |
| P11143 | WikiProjectMed ID | Imatinib |
| P3471 | WikiSkripta article ID | 50895 |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 8031 |
| P2347 | YSO ID | 28153 |
