Wikidata entity: Q209202
C₇H₆Cl₂O (P274)
Quantities
| P2067 | mass | 175.98 |
| P2101 | melting point | 59 |
| P233 | canonical SMILES | String | C1=CC(=C(C=C1Cl)Cl)CO | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q3459294 (Sodium voltage-gated channel alpha subunit 5) | Sodium voltage-gated channel alpha subunit 5 |
| P129 | physically interacts with | ... | Q6981557 (Sodium voltage-gated channel alpha subunit 4) | Sodium voltage-gated channel alpha subunit 4 |
| P129 | physically interacts with | ... | Q6981560 (Sodium voltage-gated channel alpha subunit 9) | Sodium voltage-gated channel alpha subunit 9 |
| P129 | physically interacts with | ... | Q6981561 (Sodium voltage-gated channel alpha subunit 11) | Sodium voltage-gated channel alpha subunit 11 |
| P129 | physically interacts with | ... | Q21126314 (sodium voltage-gated channel alpha subunit 1) | sodium voltage-gated channel alpha subunit 1 |
| P129 | physically interacts with | ... | Q21126334 (Sodium voltage-gated channel alpha subunit 10) | Sodium voltage-gated channel alpha subunit 10 |
| P129 | physically interacts with | ... | Q21135448 (Sodium voltage-gated channel alpha subunit 2) | Sodium voltage-gated channel alpha subunit 2 |
| P129 | physically interacts with | ... | Q21135449 (Sodium voltage-gated channel alpha subunit 3) | Sodium voltage-gated channel alpha subunit 3 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P267 | ATC code | R02AA03 |
| P231 | CAS Registry Number | 1777-82-8 |
| P683 | ChEBI ID | 48220 |
| P592 | ChEMBL ID | CHEMBL3184437 |
| P661 | ChemSpider ID | 14918 |
| P3073 | CosIng number | 33259 |
| P715 | DrugBank ID | DB13269 |
| P11198 | DrugCentral ID | 3140 |
| P8494 | DSSTOX compound identifier | DTXCID7021362 |
| P3117 | DSSTox substance ID | DTXSID9041362 |
| P232 | EC number | 217-210-5 |
| P2566 | ECHA Substance Infocard ID | 100.015.646 |
| P646 | Freebase ID | /m/026p1vf |
| P1578 | Gmelin number | 603029 |
| P234 | InChI | InChI=1S/C7H6Cl2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2 |
| P235 | InChIKey | DBHODFSFBXJZNY-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2776215048 |
| P2115 | NDF-RT ID | N0000148297 |
| P9405 | NMRShiftDB structure ID | 20039662 |
| P2840 | NSC number | 15635 |
| P11949 | PesticideInfo chemical ID | PRI1597 |
| P11199 | Probes And Drugs ID | PD013481 |
| P662 | PubChem CID | 15684 |
| P1579 | Reaxys registry number | 1448652 |
| P3345 | RxNorm CUI | 22906 |
| P2877 | SureChEMBL ID | 41323 |
| P2892 | UMLS CUI | C0057846 |
| P11089 | UniChem compound ID | 1099968 |
| P652 | UNII | 1NKX3648J9 |
Why not click here or view trends?
log id: 3614520