Wikidata entity: Q21098843
C₁₉H₂₃NO₅ (P274)
Quantities
| P2067 | mass | 345.157623 |
| P233 | canonical SMILES | String | COC1=C(C(=CC=C1)OC)OCCNCC2COC3=CC=CC=C3O2 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q4734884 (Adrenoceptor alpha 1A) | Adrenoceptor alpha 1A |
| P129 | physically interacts with | ... | Q4734886 (Adrenoceptor alpha 1B) | Adrenoceptor alpha 1B |
| P129 | physically interacts with | ... | Q4734887 (Adrenoceptor alpha 1D) | Adrenoceptor alpha 1D |
| P129 | physically interacts with | ... | Q4734891 (Adrenoceptor alpha 2C) | Adrenoceptor alpha 2C |
| P129 | physically interacts with | ... | Q4734892 (Adrenoceptor alpha 2A) | Adrenoceptor alpha 2A |
| P129 | physically interacts with | ... | Q21141045 (Adrenoceptor alpha 2B) | Adrenoceptor alpha 2B |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q1927838 (alpha blocker) | alpha blocker |
| P231 | CAS Registry Number | 613-67-2 |
| P683 | ChEBI ID | 64098 |
| P592 | ChEMBL ID | CHEMBL25554 |
| P661 | ChemSpider ID | 5483 |
| P8494 | DSSTOX compound identifier | DTXCID9023885 |
| P3117 | DSSTox substance ID | DTXSID1043885 |
| P646 | Freebase ID | /m/012dvjm2 |
| P595 | Guide to Pharmacology Ligand ID | 499 |
| P2057 | Human Metabolome Database ID | HMDB0242457 |
| P234 | InChI | InChI=1S/C19H23NO5/c1-21-17-8-5-9-18(22-2)19(17)23-11-10-20-12-14-13-24-15-6-3-4-7-16(15)25-14/h3-9,14,20H,10-13H2,1-2H3 |
| P235 | InChIKey | GYSZUJHYXCZAKI-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | C010654 |
| P11199 | Probes And Drugs ID | PD050991 |
| P662 | PubChem CID | 5685 |
| P1579 | Reaxys registry number | 4206776 |
| P2877 | SureChEMBL ID | 800982 |
| P11089 | UniChem compound ID | 344871 |
| P652 | UNII | E9H51OIT2B |
Why not click here or view trends?
log id: None