Wikidata entity: Q21098995
C₁₆H₂₆N₂O₂ (P274)
Quantities
| P2067 | mass | 278.199 |
| P233 | canonical SMILES | String | CCCCOC1=CC=CC(=C1)CCNCC(=O)N(C)C | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q3459294 (Sodium voltage-gated channel alpha subunit 5) | Sodium voltage-gated channel alpha subunit 5 |
| P129 | physically interacts with | ... | Q6981557 (Sodium voltage-gated channel alpha subunit 4) | Sodium voltage-gated channel alpha subunit 4 |
| P129 | physically interacts with | ... | Q6981560 (Sodium voltage-gated channel alpha subunit 9) | Sodium voltage-gated channel alpha subunit 9 |
| P129 | physically interacts with | ... | Q6981561 (Sodium voltage-gated channel alpha subunit 11) | Sodium voltage-gated channel alpha subunit 11 |
| P129 | physically interacts with | ... | Q21126314 (sodium voltage-gated channel alpha subunit 1) | sodium voltage-gated channel alpha subunit 1 |
| P129 | physically interacts with | ... | Q21126334 (Sodium voltage-gated channel alpha subunit 10) | Sodium voltage-gated channel alpha subunit 10 |
| P129 | physically interacts with | ... | Q21135448 (Sodium voltage-gated channel alpha subunit 2) | Sodium voltage-gated channel alpha subunit 2 |
| P129 | physically interacts with | ... | Q21135449 (Sodium voltage-gated channel alpha subunit 3) | Sodium voltage-gated channel alpha subunit 3 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 1092977-61-1 |
| P592 | ChEMBL ID | CHEMBL3678076 |
| P661 | ChemSpider ID | 44208827 |
| P715 | DrugBank ID | DB18775 |
| P3117 | DSSTox substance ID | DTXSID101032897 |
| P2671 | Google Knowledge Graph ID | /g/11bwcr5tty |
| P234 | InChI | InChI=1S/C16H26N2O2/c1-4-5-11-20-15-8-6-7-14(12-15)9-10-17-13-16(19)18(2)3/h6-8,12,17H,4-5,9-11,13H2,1-3H3 |
| P235 | InChIKey | GRHBODILPPXVKN-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2779565586 |
| P11199 | Probes And Drugs ID | PD125846 |
| P662 | PubChem CID | 25105689 |
| P2877 | SureChEMBL ID | 3025285 |
| P2877 | SureChEMBL ID | 29389974 |
| P11089 | UniChem compound ID | 33692008 |
| P652 | UNII | ON5S6N53JS |
Why not click here or view trends?
log id: 3026775