Wikidata entity: Q2211523
C₁₇H₁₉FN₂O₂ (P274)
Quantities
| P4250 | defined daily dose | 75 |
| P2067 | mass | 302.143056 |
| P3780 | active ingredient in | ... | Q29006677 (Xadago) | Xadago |
| P233 | canonical SMILES | String | CC(C(=O)N)NCC1=CC=C(C=C1)OCC2=CC(=CC=C2)F | ??? |
| P373 | Commons category | String | Safinamide | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@H](NCC1=CC=C(OCC2=CC(F)=CC=C2)C=C1)C(N)=O | ??? |
| P8026 | LiverTox likelihood score | ... | Q83284667 (LiverTox toxicity likelihood category E) | LiverTox toxicity likelihood category E |
| P2175 | medical condition treated | ... | Q11085 (Parkinson's disease) | Parkinson's disease |
| P1748 | NCI Thesaurus ID | String | C76771 | ??? |
| P129 | physically interacts with | ... | Q21109462 (Monoamine oxidase B) | Monoamine oxidase B |
| P3364 | stereoisomer of | ... | Q27166555 ((2R)-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methylamino]propanamide) | (2R)-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methylamino]propanamide |
| P279 | subclass of | ... | Q82299560 (Propanamide, 2-[[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]amino]-) | Propanamide, 2-[[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]amino]- |
| P267 | ATC code | N04BD03 |
| P231 | CAS Registry Number | 133865-89-1 |
| P683 | ChEBI ID | 134718 |
| P592 | ChEMBL ID | CHEMBL396778 |
| P661 | ChemSpider ID | 116349 |
| P715 | DrugBank ID | DB06654 |
| P11198 | DrugCentral ID | 4921 |
| P8494 | DSSTOX compound identifier | DTXCID701436700 |
| P3117 | DSSTox substance ID | DTXSID601010282 |
| P232 | EC number | 603-772-2 |
| P2566 | ECHA Substance Infocard ID | 100.120.167 |
| P646 | Freebase ID | /m/04jmqqw |
| P595 | Guide to Pharmacology Ligand ID | 8291 |
| P234 | InChI | InChI=1S/C17H19FN2O2/c1-12(17(19)21)20-10-13-5-7-16(8-6-13)22-11-14-3-2-4-15(18)9-14/h2-9,12,20H,10-11H2,1H3,(H2,19,21)/t12-/m0/s1 |
| P235 | InChIKey | NEMGRZFTLSKBAP-LBPRGKRZSA-N |
| P665 | KEGG ID | D10158 |
| P7830 | LiverTox ID | Safinamide |
| P10245 | MedlinePlus drug identifier | a617025 |
| P6366 | Microsoft Academic ID (discontinued) | 2776493724 |
| P2115 | NDF-RT ID | N0000193464 |
| P11199 | Probes And Drugs ID | PD012205 |
| P662 | PubChem CID | 131682 |
| P3345 | RxNorm CUI | 1922448 |
| P2877 | SureChEMBL ID | 69350 |
| P11089 | UniChem compound ID | 138162 |
| P652 | UNII | 90ENL74SIG |
| P11143 | WikiProjectMed ID | Safinamide |
Why not click here or view trends?
log id: 617303