Wikidata entity: Q27074792
C₂₅H₃₁N₅O₄ (P274)
Quantities
| P2067 | mass | 465.237604 |
| P233 | canonical SMILES | String | CC1COCCN1C2=NC(=NC3=C2C=CC(=N3)C4=CC(=C(C=C4)OC)CO)N5CCOCC5C | ??? |
| P366 | has use | ... | Q25326509 (chemical probe) | chemical probe |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@H]1COCCN1C2=NC(=NC3=C2C=CC(=N3)C4=CC(=C(C=C4)OC)CO)N5CCOC[C@@H]5C | ??? |
| P129 | physically interacts with | ... | Q285613 (mechanistic target of rapamycin kinase) | mechanistic target of rapamycin kinase |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 1009298-09-2 |
| P683 | ChEBI ID | 91329 |
| P592 | ChEMBL ID | CHEMBL1801204 |
| P661 | ChemSpider ID | 24747394 |
| P715 | DrugBank ID | DB12774 |
| P3117 | DSSTox substance ID | DTXSID001020704 |
| P595 | Guide to Pharmacology Ligand ID | 7714 |
| P234 | InChI | InChI=1S/C25H31N5O4/c1-16-14-33-10-8-29(16)24-20-5-6-21(18-4-7-22(32-3)19(12-18)13-31)26-23(20)27-25(28-24)30-9-11-34-15-17(30)2/h4-7,12,16-17,31H,8-11,13-15H2,1-3H3/t16-,17-/m0/s1 |
| P235 | InChIKey | KVLFRAWTRWDEDF-IRXDYDNUSA-N |
| P11199 | Probes And Drugs ID | PD003359 |
| P662 | PubChem CID | 25262965 |
| P2877 | SureChEMBL ID | 298416 |
| P11089 | UniChem compound ID | 1143829 |
| P652 | UNII | 970JJ37FPW |
Why not click here or view trends?
log id: 5266901