Wikidata entity: Q27076989
C₁₆H₁₅Cl₂N (P274)
Quantities
| P2067 | mass | 291.058155 |
| P233 | canonical SMILES | String | C1CC(C2=CC=CC=C2C1C3=CC(=C(C=C3)Cl)Cl)N | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1C[C@H](C2=CC=CC=C2[C@@H]1C3=CC(=C(C=C3)Cl)Cl)N | ??? |
| P129 | physically interacts with | ... | Q2271947 (solute carrier family 6 member 3) | solute carrier family 6 member 3 |
| P129 | physically interacts with | ... | Q7050954 (Solute carrier family 6 member 2) | Solute carrier family 6 member 2 |
| P3364 | stereoisomer of | ... | Q5264613 (N-desmethylsertraline) | N-desmethylsertraline |
| P3364 | stereoisomer of | ... | Q81983378 ((1S,4R)-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine) | (1S,4R)-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine |
| P3364 | stereoisomer of | ... | Q81983380 ((1R,4R)-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine) | (1R,4R)-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine |
| P279 | subclass of | ... | Q126610006 (cis-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine) | cis-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| P231 | CAS Registry Number | 675126-05-3 |
| P592 | ChEMBL ID | CHEMBL3301595 |
| P661 | ChemSpider ID | 8123611 |
| P715 | DrugBank ID | DB12305 |
| P8494 | DSSTOX compound identifier | DTXCID70140346 |
| P3117 | DSSTox substance ID | DTXSID20217855 |
| P646 | Freebase ID | /m/05ztnd2 |
| P595 | Guide to Pharmacology Ligand ID | 8308 |
| P234 | InChI | InChI=1S/C16H15Cl2N/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13/h1-5,7,9,11,16H,6,8,19H2/t11-,16+/m0/s1 |
| P235 | InChIKey | SRPXSILJHWNFMK-MEDUHNTESA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2779895942 |
| P11199 | Probes And Drugs ID | PD049483 |
| P662 | PubChem CID | 9947999 |
| P2877 | SureChEMBL ID | 263142 |
| P2877 | SureChEMBL ID | 29690290 |
| P11089 | UniChem compound ID | 27307647 |
| P652 | UNII | 4D28EY0L5T |
Why not click here or view trends?
log id: 2378961