Wikidata entity: Q81983378
C₁₆H₁₅Cl₂N (P274)
Quantities
| P2067 | mass | 291.05815484000004 |
| P233 | canonical SMILES | String | NC1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1C[C@@H](C2=CC=CC=C2[C@H]1C3=CC(=C(C=C3)Cl)Cl)N | ??? |
| P3364 | stereoisomer of | ... | Q5264613 (N-desmethylsertraline) | N-desmethylsertraline |
| P3364 | stereoisomer of | ... | Q27076989 (dasotraline) | dasotraline |
| P3364 | stereoisomer of | ... | Q81983380 ((1R,4R)-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine) | (1R,4R)-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine |
| P279 | subclass of | ... | Q126610006 (cis-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine) | cis-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| P231 | CAS Registry Number | 675126-06-4 |
| P8494 | DSSTOX compound identifier | DTXCID501334059 |
| P3117 | DSSTox substance ID | DTXSID10904944 |
| P234 | InChI | InChI=1S/C16H15Cl2N/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13/h1-5,7,9,11,16H,6,8,19H2/t11-,16+/m1/s1 |
| P235 | InChIKey | SRPXSILJHWNFMK-BZNIZROVSA-N |
| P11199 | Probes And Drugs ID | PD162403 |
| P662 | PubChem CID | 10356972 |
| P2877 | SureChEMBL ID | 260449 |
| P2877 | SureChEMBL ID | 29757858 |
| P11089 | UniChem compound ID | 32596383 |
Why not click here or view trends?
log id: 1573008