C₂₁H₁₈ClFN₆O₂ (P274)
Quantities
| P2067 | mass | 440.116 |
| P233 | canonical SMILES | String | CN1C(=CC=N1)NC2=NC=CC(=N2)C3=CC(=O)N(C=C3)C(CO)C4=CC(=C(C=C4)Cl)F | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CN1C(=CC=N1)NC2=NC=CC(=N2)C3=CC(=O)N(C=C3)[C@H](CO)C4=CC(=C(C=C4)Cl)F | ??? |
| P129 | physically interacts with | ... | Q6590503 (mitogen-activated protein kinase 1) | mitogen-activated protein kinase 1 |
| P129 | physically interacts with | ... | Q6714406 (mitogen-activated protein kinase 3) | mitogen-activated protein kinase 3 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 1453848-26-4 |
| P592 | ChEMBL ID | CHEMBL3544964 |
| P661 | ChemSpider ID | 32501977 |
| P715 | DrugBank ID | DB15281 |
| P595 | Guide to Pharmacology Ligand ID | 9229 |
| P234 | InChI | InChI=1S/C21H18ClFN6O2/c1-28-19(5-8-25-28)27-21-24-7-4-17(26-21)13-6-9-29(20(31)11-13)18(12-30)14-2-3-15(22)16(23)10-14/h2-11,18,30H,12H2,1H3,(H,24,26,27)/t18-/m1/s1 |
| P235 | InChIKey | RZUOCXOYPYGSKL-GOSISDBHSA-N |
| P3636 | PDB ligand ID | 6QB |
| P638 | PDB structure ID | 5K4J |
| P638 | PDB structure ID | 5K4I |
| P11199 | Probes And Drugs ID | PD021570 |
| P662 | PubChem CID | 71727581 |
| P2877 | SureChEMBL ID | 15245531 |
| P11089 | UniChem compound ID | 59175340 |
| P652 | UNII | R6AXV96CRH |
Why not click here or view trends?
log id: 10205860