Wikidata entity: Q27107089
C₁₉H₂₄N₂O₆ (P274)
Quantities
| P2067 | mass | 376.163 |
| P233 | canonical SMILES | String | C1CN2C(=CC=C2C(=O)C3=CC=CC=C3)C1C(=O)O.C(C(CO)(CO)N)O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P3493 | legal status (medicine) | ... | Q879952 (boxed warning) | boxed warning |
| P2175 | medical condition treated | ... | Q81938 (pain) | pain |
| P2175 | medical condition treated | ... | Q281289 (photophobia) | photophobia |
| P2175 | medical condition treated | ... | Q101991 (inflammation) | inflammation |
| P2175 | medical condition treated | ... | Q2152449 (giant papillary conjunctivitis) | giant papillary conjunctivitis |
| P129 | physically interacts with | ... | Q415364 (Prostaglandin-endoperoxide synthase 2) | Prostaglandin-endoperoxide synthase 2 |
| P129 | physically interacts with | ... | Q21126810 (Prostaglandin-endoperoxide synthase 1) | Prostaglandin-endoperoxide synthase 1 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q188724 (non-steroidal anti-inflammatory drug) | non-steroidal anti-inflammatory drug |
| P2868 | subject has role | ... | Q20522059 (cyclooxygenase inhibitors) | cyclooxygenase inhibitors |
| P231 | CAS Registry Number | 74103-07-4 |
| P683 | ChEBI ID | 6130 |
| P592 | ChEMBL ID | CHEMBL1201124 |
| P661 | ChemSpider ID | 75795 |
| P715 | DrugBank ID | DBSALT001045 |
| P8494 | DSSTOX compound identifier | DTXCID8025597 |
| P3117 | DSSTox substance ID | DTXSID0045597 |
| P232 | EC number | 620-545-3 |
| P2566 | ECHA Substance Infocard ID | 100.149.467 |
| P234 | InChI | InChI=1S/C15H13NO3.C4H11NO3/c17-14(10-4-2-1-3-5-10)13-7-6-12-11(15(18)19)8-9-16(12)13;5-4(1-6,2-7)3-8/h1-7,11H,8-9H2,(H,18,19);6-8H,1-3,5H2 |
| P235 | InChIKey | BWHLPLXXIDYSNW-UHFFFAOYSA-N |
| P665 | KEGG ID | D00813 |
| P486 | MeSH descriptor ID | D020911 |
| P672 | MeSH tree code | D03.633.100.473.420.742 |
| P2115 | NDF-RT ID | N0000147630 |
| P2840 | NSC number | 758637 |
| P11199 | Probes And Drugs ID | PD000805 |
| P662 | PubChem CID | 84003 |
| P662 | PubChem CID | 45357356 |
| P1579 | Reaxys registry number | 6463165 |
| P3345 | RxNorm CUI | 28200 |
| P4964 | SPLASH | splash10-0a4i-1590000000-02c518ae14314077c1a7 |
| P2877 | SureChEMBL ID | 5036 |
| P2892 | UMLS CUI | C0064326 |
| P11089 | UniChem compound ID | 414765 |
| P652 | UNII | 4EVE5946BQ |
Why not click here or view trends?
log id: 1903242