Wikidata entity: Q27114764
C₁₃H₂₁ClN₂O (P274)
Quantities
| P2067 | mass | 256.134 |
| P233 | canonical SMILES | String | CCCNC(C)C(=O)NC1=CC=CC=C1C.Cl | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q3459294 (Sodium voltage-gated channel alpha subunit 5) | Sodium voltage-gated channel alpha subunit 5 |
| P129 | physically interacts with | ... | Q6981557 (Sodium voltage-gated channel alpha subunit 4) | Sodium voltage-gated channel alpha subunit 4 |
| P129 | physically interacts with | ... | Q6981560 (Sodium voltage-gated channel alpha subunit 9) | Sodium voltage-gated channel alpha subunit 9 |
| P129 | physically interacts with | ... | Q6981561 (Sodium voltage-gated channel alpha subunit 11) | Sodium voltage-gated channel alpha subunit 11 |
| P129 | physically interacts with | ... | Q21126314 (sodium voltage-gated channel alpha subunit 1) | sodium voltage-gated channel alpha subunit 1 |
| P129 | physically interacts with | ... | Q21126334 (Sodium voltage-gated channel alpha subunit 10) | Sodium voltage-gated channel alpha subunit 10 |
| P129 | physically interacts with | ... | Q21135448 (Sodium voltage-gated channel alpha subunit 2) | Sodium voltage-gated channel alpha subunit 2 |
| P129 | physically interacts with | ... | Q21135449 (Sodium voltage-gated channel alpha subunit 3) | Sodium voltage-gated channel alpha subunit 3 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 1786-81-8 |
| P683 | ChEBI ID | 32053 |
| P592 | ChEMBL ID | CHEMBL1200586 |
| P661 | ChemSpider ID | 83207 |
| P8494 | DSSTOX compound identifier | DTXCID0011956 |
| P3117 | DSSTox substance ID | DTXSID2031956 |
| P232 | EC number | 217-244-0 |
| P2566 | ECHA Substance Infocard ID | 100.015.677 |
| P234 | InChI | InChI=1S/C13H20N2O.ClH/c1-4-9-14-11(3)13(16)15-12-8-6-5-7-10(12)2;/h5-8,11,14H,4,9H2,1-3H3,(H,15,16);1H |
| P235 | InChIKey | BJPJNTKRKALCPP-UHFFFAOYSA-N |
| P665 | KEGG ID | D01243 |
| P2115 | NDF-RT ID | N0000147204 |
| P2840 | NSC number | 758432 |
| P11199 | Probes And Drugs ID | PD001011 |
| P662 | PubChem CID | 92163 |
| P662 | PubChem CID | 53262280 |
| P662 | PubChem CID | 68805528 |
| P1579 | Reaxys registry number | 6541935 |
| P3345 | RxNorm CUI | 2557 |
| P2877 | SureChEMBL ID | 330180 |
| P2892 | UMLS CUI | C0008846 |
| P652 | UNII | MJW015BAPH |
Why not click here or view trends?
log id: 4119217