| type of chemical entity | Q113145171 |
| indole alkaloid | Q408452 |
| fumiquinazoline | Q16873863 |
| P233 | canonical SMILES | CC1C2=NC3=CC=CC=C3C(=O)N2C(C(=O)N1)CC4=CNC5=CC=CC=C54 |
| P231 | CAS Registry Number | 169626-35-1 |
| P683 | ChEBI ID | 64550 |
| P592 | ChEMBL ID | CHEMBL2229117 |
| P661 | ChemSpider ID | 8265309 |
| P8494 | DSSTOX compound identifier | DTXCID601031268 |
| P3117 | DSSTox substance ID | DTXSID30891847 |
| P234 | InChI | InChI=1S/C21H18N4O2/c1-12-19-24-17-9-5-3-7-15(17)21(27)25(19)18(20(26)23-12)10-13-11-22-16-8-4-2-6-14(13)16/h2-9,11-12,18,22H,10H2,1H3,(H,23,26)/t12-,18+/m0/s1 |
| P235 | InChIKey | SUVZUTHVKIBYOH-KPZWWZAWSA-N |
| P2017 | isomeric SMILES | C[C@H]1C2=NC3=CC=CC=C3C(=O)N2[C@@H](C(=O)N1)CC4=CNC5=CC=CC=C54 |
| P6689 | MassBank accession ID | MSBNK-AAFC-AC000907 |
| MSBNK-AAFC-AC000908 | ||
| MSBNK-AAFC-AC000909 | ||
| MSBNK-AAFC-AC000910 | ||
| MSBNK-AAFC-AC000911 | ||
| MSBNK-AAFC-AC000912 | ||
| MSBNK-AAFC-AC000913 | ||
| MSBNK-AAFC-AC000914 | ||
| MSBNK-AAFC-AC000915 | ||
| P7746 | Natural Product Atlas ID | NPA019431 |
| P662 | PubChem CID | 10089772 |
| P1579 | Reaxys registry number | 7417628 |
| P11089 | UniChem compound ID | 27202723 |
| P703 | found in taxon | Aspergillus fumigatus | Q134359 |
| Aspergillus | Q335130 | ||
| Penicillium corylophilum | Q10622912 | ||
| Penicillium thymicola | Q10623077 | ||
| P2067 | mass | 358.143 | |
| P3364 | stereoisomer of | (1R,4R)-4-(1H-indol-3-ylmethyl)-1-methyl-2,4-dihydro-1H-pyrazino[2,1-b]quinazoline-3,6-dione | Q105261539 |
| Q51377038 | Alkaloidal metabolites from a marine-derived Aspergillus sp. fungus. |
| Q34383820 | Antibacterial activity from Penicillium corylophilum Dierckx. |
| Q35355749 | Complexity generation in fungal peptidyl alkaloid biosynthesis: oxidation of fumiquinazoline A to the heptacyclic hemiaminal fumiquinazoline C by the flavoenzyme Af12070 from Aspergillus fumigatus. |
| Q34425191 | Enzymatic processing of fumiquinazoline F: a tandem oxidative-acylation strategy for the generation of multicyclic scaffolds in fungal indole alkaloid biosynthesis |
| Q78432045 | Fumiquinazolines A–G, novel metabolites of a fungus separated from a Pseudolabrus marine fish |
| Q42013928 | Metabolites from Aspergillus fumigatus, an endophytic fungus associated with Melia azedarach, and their antifungal, antifeedant, and toxic activities |
| Q46623571 | Three-component one-pot total syntheses of glyantrypine, fumiquinazoline F, and fiscalin B promoted by microwave irradiation |
| Q44280297 | Total synthesis of (-)-fumiquinazolines A, B, C, E, H, and I. Approaches to the synthesis of fiscalin A. |
| Q30856051 | Total synthesis of the fumiquinazoline alkaloids: solid-phase studies. |
| Q73798878 | Total synthesis of the fumiquinazoline alkaloids: solution-phase studies |
| Q55067993 | UV-Guided isolation of alantrypinone, a novel Penicillium alkaloid. |
| Q105261539 | (1R,4R)-4-(1H-indol-3-ylmethyl)-1-methyl-2,4-dihydro-1H-pyrazino[2,1-b]quinazoline-3,6-dione | stereoisomer of | P3364 |
Search more.