Wikidata entity: Q27273145
C₂₇H₃₆N₂O₅ (P274)
Quantities
| P2067 | mass | 468.262 |
| P233 | canonical SMILES | String | CN(CCCN1CCC2=CC(=C(C=C2CC1=O)OC)OC)CC3CC4=CC(=C(C=C34)OC)OC | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CN(CCCN1CCC2=CC(=C(C=C2CC1=O)OC)OC)C[C@@H]3CC4=CC(=C(C=C34)OC)OC | ??? |
| P3364 | stereoisomer of | ... | Q425729 (ivabradine) | ivabradine |
| P279 | subclass of | ... | Q27275319 ((+/-)-ivabradine) | (+/-)-ivabradine |
| P231 | CAS Registry Number | 167072-91-5 |
| P661 | ChemSpider ID | 10250937 |
| P8494 | DSSTOX compound identifier | DTXCID9090715 |
| P3117 | DSSTox substance ID | DTXSID90168224 |
| P234 | InChI | InChI=1S/C27H36N2O5/c1-28(17-21-11-20-14-25(33-4)26(34-5)16-22(20)21)8-6-9-29-10-7-18-12-23(31-2)24(32-3)13-19(18)15-27(29)30/h12-14,16,21H,6-11,15,17H2,1-5H3/t21-/m0/s1 |
| P235 | InChIKey | ACRHBAYQBXXRTO-NRFANRHFSA-N |
| P11199 | Probes And Drugs ID | PD062640 |
| P662 | PubChem CID | 21625941 |
| P2877 | SureChEMBL ID | 333201 |
| P11089 | UniChem compound ID | 27190518 |
| P652 | UNII | 9T270O3E9P |
Why not click here or view trends?
log id: 2840189