| type of chemical entity | Q113145171 |
| 3-Methyl-2-[[2-(3-oxo-2-pent-2-enylcyclopentyl)acetyl]amino]pentanoic acid | Q104168607 |
| P233 | canonical SMILES | CCC=CCC1C(CCC1=O)CC(=O)NC(C(C)CC)C(=O)O |
| P231 | CAS Registry Number | 145414-77-3 |
| P683 | ChEBI ID | 137043 |
| P661 | ChemSpider ID | 24604905 |
| P3117 | DSSTox substance ID | DTXSID801304786 |
| P234 | InChI | InChI=1S/C18H29NO4/c1-4-6-7-8-14-13(9-10-15(14)20)11-16(21)19-17(18(22)23)12(3)5-2/h6-7,12-14,17H,4-5,8-11H2,1-3H3,(H,19,21)(H,22,23)/b7-6-/t12-,13+,14-,17-/m0/s1 |
| P235 | InChIKey | IBZYPBGPOGJMBF-QPERPISQSA-N |
| P2017 | isomeric SMILES | CC/C=C\C[C@H]1[C@H](CCC1=O)CC(=O)N[C@@H]([C@@H](C)CC)C(=O)O |
| P2064 | KNApSAcK ID | C00059969 |
| P3636 | PDB ligand ID | 7JA |
| P638 | PDB structure ID | 3OGL |
| P662 | PubChem CID | 25190944 |
| P11089 | UniChem compound ID | 654800 |
| P703 | found in taxon | Arabidopsis thaliana | Q158695 |
| P2067 | mass | 323.21 | |
| P3364 | stereoisomer of | (2S,3S)-3-methyl-2-[[2-[(1R,2R)-3-oxo-2-pent-2-enylcyclopentyl]acetyl]amino]pentanoic acid | Q115946458 |
| (-)-Jasmonoyl-L-isoleucine | Q27155650 | ||
| N-<(+)-7-iso-jasmonoyl-(S)>-isoleucine | Q77505327 | ||
| N-<(-)-jasmonoyl-(S)>-isoleucine | Q77569402 | ||
| N-[(3R)-jasmonyl]-L-isoleucine | Q106029351 |
| Q27155650 | (-)-Jasmonoyl-L-isoleucine |
| Q115946458 | (2S,3S)-3-methyl-2-[[2-[(1R,2R)-3-oxo-2-pent-2-enylcyclopentyl]acetyl]amino]pentanoic acid |
| Q77505327 | N-<(+)-7-iso-jasmonoyl-(S)>-isoleucine |
| Q77569402 | N-<(-)-jasmonoyl-(S)>-isoleucine |
| Q106029351 | N-[(3R)-jasmonyl]-L-isoleucine |
| Q34606303 | (+)-7-iso-Jasmonoyl-L-isoleucine is the endogenous bioactive jasmonate |
| Q30315883 | A previously undescribed jasmonate compound in flowering Arabidopsis thaliana - The identification of cis-(+)-OPDA-Ile |
| Q43220778 | A tomato enzyme synthesizes (+)-7-iso-jasmonoyl-L-isoleucine in wounded leaves |
| Q38046505 | Chemical and genetic exploration of jasmonate biosynthesis and signaling paths |
| Q48291278 | Endogenous Bioactive Jasmonate Is Composed of a Set of (+)-7-iso-JA-Amino Acid Conjugates |
| Q42259704 | Inhibition of arabidopsis hypocotyl elongation by jasmonates is enhanced under red light in phytochrome B dependent manner |
| Q43100042 | Jasmonates are phytohormones with multiple functions, including plant defense and reproduction |
| Q30318828 | Jasmonates: structural requirements for lipid-derived signals active in plant stress responses and development |
| Q30317479 | Perception, signaling and cross-talk of jasmonates and the seminal contributions of the Daoxin Xie's lab and the Chuanyou Li's lab. |
| Q37606754 | Regulation of gene expression by jasmonate hormones. |
| Q38118924 | Role of plant peroxisomes in the production of jasmonic acid-based signals |
| Q51429373 | Synthesis of 6-substituted 1-oxoindanoyl isoleucine conjugates and modeling studies with the COI1-JAZ co-receptor complex of lima bean. |
| Q34219385 | The genuine ligand of a jasmonic acid receptor: improved analysis of jasmonates is now required |
| Q37589102 | The jasmonate pathway: the ligand, the receptor and the core signalling module. |
Search more.