type of chemical entity | Q113145171 |
3-Methyl-2-[[2-(3-oxo-2-pent-2-enylcyclopentyl)acetyl]amino]pentanoic acid | Q104168607 |
P233 | canonical SMILES | CCC=CCC1C(=O)CCC1CC(=O)NC(C(=O)O)C(C)CC |
P683 | ChEBI ID | 220708 |
P234 | InChI | InChI=1S/C18H29NO4/c1-4-6-7-8-14-13(9-10-15(14)20)11-16(21)19-17(18(22)23)12(3)5-2/h6-7,12-14,17H,4-5,8-11H2,1-3H3,(H,19,21)(H,22,23)/b7-6-/t12-,13-,14-,17+/m1/s1 |
P235 | InChIKey | IBZYPBGPOGJMBF-WTKQXPPDSA-N |
P2017 | isomeric SMILES | CC/C=C\C[C@@H]1[C@H](CCC1=O)CC(=O)N[C@@H]([C@H](C)CC)C(=O)O |
P7746 | Natural Product Atlas ID | NPA016110 |
P662 | PubChem CID | 139587570 |
P11089 | UniChem compound ID | 153368939 |
P703 | found in taxon | Fusarium oxysporum | Q139958 |
Fusarium fujikuroi | Q10500328 | ||
P2067 | mass | 323.209658408 | |
P3364 | stereoisomer of | (2S,3S)-3-methyl-2-[[2-[(1R,2R)-3-oxo-2-pent-2-enylcyclopentyl]acetyl]amino]pentanoic acid | Q115946458 |
(-)-Jasmonoyl-L-isoleucine | Q27155650 | ||
N-({(1R,2S)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetyl)-L-isoleucine | Q27456735 | ||
N-<(+)-7-iso-jasmonoyl-(S)>-isoleucine | Q77505327 | ||
N-[(3R)-jasmonyl]-L-isoleucine | Q106029351 |
Q27155650 | (-)-Jasmonoyl-L-isoleucine |
Q115946458 | (2S,3S)-3-methyl-2-[[2-[(1R,2R)-3-oxo-2-pent-2-enylcyclopentyl]acetyl]amino]pentanoic acid |
Q27456735 | N-({(1R,2S)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetyl)-L-isoleucine |
Q77505327 | N-<(+)-7-iso-jasmonoyl-(S)>-isoleucine |
Q106029351 | N-[(3R)-jasmonyl]-L-isoleucine |
Q104886928 | Cyclopentane fatty acids from Gibberella fujikuroi |
Q103813334 | Jasmonates and related compounds from Fusarium oxysporum |
Search more.