Wikidata entity: Q4890814
C₂₂H₃₂N₂O₅ (P274)
Quantities
| P2067 | mass | 404.231122 |
| P233 | canonical SMILES | String | CCN(CC)C(=O)C1CN2CCC3=CC(=C(C=C3C2CC1OC(=O)C)OC)OC | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q127076 (vomiting) | vomiting |
| P129 | physically interacts with | ... | Q415364 (Prostaglandin-endoperoxide synthase 2) | Prostaglandin-endoperoxide synthase 2 |
| P129 | physically interacts with | ... | Q2034004 (Dopamine receptor D2) | Dopamine receptor D2 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 63-12-7 |
| P683 | ChEBI ID | 27662 |
| P592 | ChEMBL ID | CHEMBL1201250 |
| P661 | ChemSpider ID | 2252 |
| P715 | DrugBank ID | DB00767 |
| P11198 | DrugCentral ID | 331 |
| P8494 | DSSTOX compound identifier | DTXCID702657 |
| P3117 | DSSTox substance ID | DTXSID9022657 |
| P646 | Freebase ID | /m/0gfgmw8 |
| P595 | Guide to Pharmacology Ligand ID | 7124 |
| P2062 | HSDB ID | 3295 |
| P2057 | Human Metabolome Database ID | HMDB0014905 |
| P234 | InChI | InChI=1S/C22H32N2O5/c1-6-23(7-2)22(26)17-13-24-9-8-15-10-20(27-4)21(28-5)11-16(15)18(24)12-19(17)29-14(3)25/h10-11,17-19H,6-9,12-13H2,1-5H3 |
| P235 | InChIKey | JSZILQVIPPROJI-UHFFFAOYSA-N |
| P665 | KEGG ID | D00243 |
| P2115 | NDF-RT ID | N0000147722 |
| P11199 | Probes And Drugs ID | PD009110 |
| P662 | PubChem CID | 2342 |
| P1579 | Reaxys registry number | 502385 |
| P3345 | RxNorm CUI | 19041 |
| P2877 | SureChEMBL ID | 49405 |
| P2892 | UMLS CUI | C0053284 |
| P11089 | UniChem compound ID | 46580 |
| P652 | UNII | 0475EA27Q3 |
Why not click here or view trends?
log id: 5945636