Wikidata entity: Q5007568
C₁₃H₈N₄OS (P274)
Quantities
| P2067 | mass | 268.042 |
| P233 | canonical SMILES | String | C1=CC2=C(C3=C1NC(=O)C3=CC4=CN=CN4)SC=N2 | ??? |
| P1889 | different from | ... | Q31891220 (???) | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1=CC2=C(C\3=C1NC(=O)/C3=C\C4=CN=CN4)SC=N2 | ??? |
| P129 | physically interacts with | ... | Q7251483 (Eukaryotic translation initiation factor 2 alpha kinase 2) | Eukaryotic translation initiation factor 2 alpha kinase 2 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q742487 (nootropic) | nootropic |
| P231 | CAS Registry Number | 608512-97-6 |
| P683 | ChEBI ID | 232603 |
| P592 | ChEMBL ID | CHEMBL235641 |
| P661 | ChemSpider ID | 4990932 |
| P232 | EC number | 685-966-7 |
| P2566 | ECHA Substance Infocard ID | 100.211.648 |
| P646 | Freebase ID | /m/0hr4rv_ |
| P595 | Guide to Pharmacology Ligand ID | 6026 |
| P234 | InChI | InChI=1S/C13H8N4OS/c18-13-8(3-7-4-14-5-15-7)11-9(17-13)1-2-10-12(11)19-6-16-10/h1-6H,(H,14,15)(H,17,18)/b8-3- |
| P235 | InChIKey | VFBGXTUGODTSPK-BAQGIRSFSA-N |
| P3636 | PDB ligand ID | 34L |
| P638 | PDB structure ID | 4QMO |
| P11199 | Probes And Drugs ID | PD015705 |
| P662 | PubChem CID | 6490494 |
| P2877 | SureChEMBL ID | 1395126 |
| P11089 | UniChem compound ID | 427246 |
| P652 | UNII | C9Q75QZK84 |
Why not click here or view trends?
log id: 5199777