Wikidata entity: Q72443855
C₂₀H₁₈O₆ (P274)
Quantities
| P2067 | mass | 354.1103382959999 |
| P233 | canonical SMILES | String | c1cc2c(cc1C1OCC3C(c4ccc5c(c4)OCO5)OCC13)OCO2 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | c1cc2c(cc1[C@H]1OC[C@H]3[C@@H]1CO[C@H]3c1ccc3c(c1)OCO3)OCO2 | ??? |
| P3364 | stereoisomer of | ... | Q3511416 ((+)-sesamin) | (+)-sesamin |
| P3364 | stereoisomer of | ... | Q27256222 (asarinin) | asarinin |
| P3364 | stereoisomer of | ... | Q27273279 ((-)-sesamin) | (-)-sesamin |
| P3364 | stereoisomer of | ... | Q104394002 (Episesamin) | Episesamin |
| P3364 | stereoisomer of | ... | Q105207550 (Epiasarinin) | Epiasarinin |
| P279 | subclass of | ... | Q104253528 (5-[(3aR,6R,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole) | 5-[(3aR,6R,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole |
| P231 | CAS Registry Number | 133-05-1 |
| P3117 | DSSTox substance ID | DTXSID201033462 |
| P234 | InChI | InChI=1S/C20H18O6/c1-3-15-17(25-9-23-15)5-11(1)19-13-7-22-20(14(13)8-21-19)12-2-4-16-18(6-12)26-10-24-16/h1-6,13-14,19-20H,7-10H2/t13-,14-,19-,20+/m0/s1 |
| P235 | InChIKey | PEYUIKBAABKQKQ-WZBLMQSHSA-N |
| P662 | PubChem CID | 101612 |
| P2877 | SureChEMBL ID | 976772 |
| P652 | UNII | C3RVX72NMG |
| P652 | UNII | F6PWY73ZGT |
Why not click here or view trends?
log id: 5605252