Wikidata entity: Q7702355
C₂₀H₂₈N₄O (P274)
Quantities
| P2067 | mass | 340.226312 |
| P233 | canonical SMILES | String | CCN(CC)C(=O)NC1CC2C(CC3=CNC4=CC=CC2=C34)N(C1)C | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCN(CC)C(=O)N[C@H]1C[C@H]2[C@@H](CC3=CNC4=CC=CC2=C34)N(C1)C | ??? |
| P129 | physically interacts with | ... | Q288797 (5-hydroxytryptamine receptor 1B) | 5-hydroxytryptamine receptor 1B |
| P129 | physically interacts with | ... | Q308856 (Dopamine receptor D4) | Dopamine receptor D4 |
| P129 | physically interacts with | ... | Q1949517 (5-hydroxytryptamine receptor 2A) | 5-hydroxytryptamine receptor 2A |
| P129 | physically interacts with | ... | Q2034004 (Dopamine receptor D2) | Dopamine receptor D2 |
| P129 | physically interacts with | ... | Q4639596 (5-hydroxytryptamine receptor 2B) | 5-hydroxytryptamine receptor 2B |
| P129 | physically interacts with | ... | Q4734884 (Adrenoceptor alpha 1A) | Adrenoceptor alpha 1A |
| P129 | physically interacts with | ... | Q4734891 (Adrenoceptor alpha 2C) | Adrenoceptor alpha 2C |
| P129 | physically interacts with | ... | Q4734892 (Adrenoceptor alpha 2A) | Adrenoceptor alpha 2A |
| P129 | physically interacts with | ... | Q21108118 (5-hydroxytryptamine receptor 2C) | 5-hydroxytryptamine receptor 2C |
| P129 | physically interacts with | ... | Q21110872 (Dopamine receptor D3) | Dopamine receptor D3 |
| P129 | physically interacts with | ... | Q21115043 (5-hydroxytryptamine receptor 1A) | 5-hydroxytryptamine receptor 1A |
| P129 | physically interacts with | ... | Q21115046 (5-hydroxytryptamine receptor 1D) | 5-hydroxytryptamine receptor 1D |
| P129 | physically interacts with | ... | Q21141045 (Adrenoceptor alpha 2B) | Adrenoceptor alpha 2B |
| P3364 | stereoisomer of | ... | Q27163897 (3-[(6aR,9R,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-yl]-1,1-diethylurea) | 3-[(6aR,9R,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-yl]-1,1-diethylurea |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q600203 (dopamine agonist) | dopamine agonist |
| P267 | ATC code | G02CB06 |
| P231 | CAS Registry Number | 37686-84-3 |
| P683 | ChEBI ID | 32193 |
| P592 | ChEMBL ID | CHEMBL73151 |
| P661 | ChemSpider ID | 392004 |
| P715 | DrugBank ID | DB13399 |
| P11198 | DrugCentral ID | 2601 |
| P8494 | DSSTOX compound identifier | DTXCID1025809 |
| P3117 | DSSTox substance ID | DTXSID3045809 |
| P232 | EC number | 253-624-2 |
| P2566 | ECHA Substance Infocard ID | 100.048.732 |
| P646 | Freebase ID | /m/04dyybn |
| P595 | Guide to Pharmacology Ligand ID | 56 |
| P234 | InChI | InChI=1S/C20H28N4O/c1-4-24(5-2)20(25)22-14-10-16-15-7-6-8-17-19(15)13(11-21-17)9-18(16)23(3)12-14/h6-8,11,14,16,18,21H,4-5,9-10,12H2,1-3H3,(H,22,25)/t14-,16+,18+/m0/s1 |
| P235 | InChIKey | JOAHPSVPXZTVEP-YXJHDRRASA-N |
| P665 | KEGG ID | D01348 |
| P486 | MeSH descriptor ID | C006208 |
| P6366 | Microsoft Academic ID (discontinued) | 2776941319 |
| P11199 | Probes And Drugs ID | PD014387 |
| P662 | PubChem CID | 443951 |
| P2877 | SureChEMBL ID | 147259 |
| P11089 | UniChem compound ID | 291763 |
| P652 | UNII | 21OJT43Q88 |
Why not click here or view trends?
log id: 2108335