Wikidata entity: Q27078057
C₁₂H₁₄N₂O₂ (P274)
Quantities
| P2067 | mass | 218.106 |
| P233 | canonical SMILES | String | CN1C=C(C2=CC=CC=C21)CC(C(=O)O)N | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CN1C=C(C2=CC=CC=C21)C[C@H](C(=O)O)N | ??? |
| P129 | physically interacts with | ... | Q285613 (mechanistic target of rapamycin kinase) | mechanistic target of rapamycin kinase |
| P129 | physically interacts with | ... | Q21115067 (Regulatory associated protein of MTOR complex 1) | Regulatory associated protein of MTOR complex 1 |
| P3364 | stereoisomer of | ... | Q27070849 (1-methyl-L-tryptophan) | 1-methyl-L-tryptophan |
| P279 | subclass of | ... | Q4545793 (1-methyltryptophan) | 1-methyltryptophan |
| P231 | CAS Registry Number | 110117-83-4 |
| P683 | ChEBI ID | 230682 |
| P592 | ChEMBL ID | CHEMBL571209 |
| P661 | ChemSpider ID | 358642 |
| P715 | DrugBank ID | DB12827 |
| P8494 | DSSTOX compound identifier | DTXCID701340535 |
| P3117 | DSSTox substance ID | DTXSID40911500 |
| P595 | Guide to Pharmacology Ligand ID | 8226 |
| P234 | InChI | InChI=1S/C12H14N2O2/c1-14-7-8(6-10(13)12(15)16)9-4-2-3-5-11(9)14/h2-5,7,10H,6,13H2,1H3,(H,15,16)/t10-/m1/s1 |
| P235 | InChIKey | ZADWXFSZEAPBJS-SNVBAGLBSA-N |
| P11901 | NCI Dictionary of Cancer Terms entry | d-1mt |
| P2840 | NSC number | 721782 |
| P11199 | Probes And Drugs ID | PD012398 |
| P662 | PubChem CID | 405012 |
| P662 | PubChem CID | 6920151 |
| P2877 | SureChEMBL ID | 934800 |
| P652 | UNII | TX5CYN1KMZ |
Why not click here or view trends?
log id: 5801496